About 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one
1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one (PubChem CID 142097963) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one |
| PubChem CID | 142097963 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one |
| SMILES | Cc1cc(=O)n(CCCN)c(O)c1C |
| InChI | InChI=1S/C10H16N2O2/c1-7-6-9(13)12(5-3-4-11)10(14)8(7)2/h6,14H,3-5,11H2,1-2H3 |
| InChIKey | QPLYVHMOMDXZIC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one?
The IUPAC name of 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one (CID 142097963) is 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one.
What is the SMILES notation for 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one?
The canonical SMILES for 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one is Cc1cc(=O)n(CCCN)c(O)c1C.
What is the InChIKey of 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one?
The InChIKey is QPLYVHMOMDXZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-7-6-9(13)12(5-3-4-11)10(14)8(7)2/h6,14H,3-5,11H2,1-2H3.
What are the key properties of 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one?
1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one has a molecular weight of 196.25 g/mol, XLogP of 0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminopropyl)-6-hydroxy-4,5-dimethylpyridin-2-one is sourced from PubChem (CID 142097963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).