C31H29NO6 — CID 142097997
5-[(E)-3-(7-hydroxy-2-oxochromen-3-yl)-3-oxoprop-1-enyl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 142097997) has the molecular formula C31H29NO6 and a molecular weight of 511.57 g/mol. Its IUPAC name is 5-[(E)-3-(7-hydroxy-2-oxochromen-3-yl)-3-oxoprop-1-enyl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-[(E)-3-(7-hydroxy-2-oxochromen-3-yl)-3-oxoprop-1-enyl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 142097997 |
| Molecular Formula | C31H29NO6 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 5-[(E)-3-(7-hydroxy-2-oxochromen-3-yl)-3-oxoprop-1-enyl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c2c1cc1cc(/C=C/C(=O)c2cc4ccc(O)cc4oc2=O)c(=O)oc31 |
| InChI | InChI=1S/C31H29NO6/c1-30(2)9-11-32-12-10-31(3,4)25-26(32)22(30)15-19-13-18(28(35)38-27(19)25)6-8-23(34)21-14-17-5-7-20(33)16-24(17)37-29(21)36/h5-8,13-16,33H,9-12H2,1-4H3/b8-6+ |
| InChIKey | ZEFZDGZRQUJZKO-SOFGYWHQSA-N |
| XLogP | 5.67 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|