C32H29Br2NO5 — CID 142098021
5-[(E)-3-(6,8-dibromo-2-oxochromen-3-yl)-3-oxoprop-1-enyl]-6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 142098021) has the molecular formula C32H29Br2NO5 and a molecular weight of 667.39 g/mol. Its IUPAC name is 5-[(E)-3-(6,8-dibromo-2-oxochromen-3-yl)-3-oxoprop-1-enyl]-6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-[(E)-3-(6,8-dibromo-2-oxochromen-3-yl)-3-oxoprop-1-enyl]-6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 142098021 |
| Molecular Formula | C32H29Br2NO5 |
| Molecular Weight | 667.39 g/mol |
| Exact Mass | 665.04 |
| IUPAC Name | 5-[(E)-3-(6,8-dibromo-2-oxochromen-3-yl)-3-oxoprop-1-enyl]-6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | Cc1c(/C=C/C(=O)c2cc3cc(Br)cc(Br)c3oc2=O)c(=O)oc2c3c4c(cc12)C(C)(C)CCN4CCC3(C)C |
| InChI | InChI=1S/C32H29Br2NO5/c1-16-19(6-7-24(36)21-13-17-12-18(33)14-23(34)27(17)39-30(21)38)29(37)40-28-20(16)15-22-26-25(28)32(4,5)9-11-35(26)10-8-31(22,2)3/h6-7,12-15H,8-11H2,1-5H3/b7-6+ |
| InChIKey | MQOPJLYMEAYBHY-VOTSOKGWSA-N |
| XLogP | 7.80 |
| TPSA | 80.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.39 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|