C27H38N4O6S2 — CID 142098255
(E)-N-[(2S)-3-cyclohexyl-1-oxo-1-[(3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)amino]propan-2-yl]-3-hydroxy-2-[(Z)-prop-1-enyl]sulfanylbut-2-enamide (PubChem CID 142098255) has the molecular formula C27H38N4O6S2 and a molecular weight of 578.76 g/mol. Its IUPAC name is (E)-N-[(2S)-3-cyclohexyl-1-oxo-1-[(3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)amino]propan-2-yl]-3-hydroxy-2-[(Z)-prop-1-enyl]sulfanylbut-2-enamide.
| Compound Name | (E)-N-[(2S)-3-cyclohexyl-1-oxo-1-[(3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)amino]propan-2-yl]-3-hydroxy-2-[(Z)-prop-1-enyl]sulfanylbut-2-enamide |
|---|---|
| PubChem CID | 142098255 |
| Molecular Formula | C27H38N4O6S2 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | (E)-N-[(2S)-3-cyclohexyl-1-oxo-1-[(3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)amino]propan-2-yl]-3-hydroxy-2-[(Z)-prop-1-enyl]sulfanylbut-2-enamide |
| SMILES | C/C=C\S/C(C(=O)N[C@@H](CC1CCCCC1)C(=O)NC1CCCN(S(=O)(=O)c2ccccn2)CC1=O)=C(\C)O |
| InChI | InChI=1S/C27H38N4O6S2/c1-3-16-38-25(19(2)32)27(35)30-22(17-20-10-5-4-6-11-20)26(34)29-21-12-9-15-31(18-23(21)33)39(36,37)24-13-7-8-14-28-24/h3,7-8,13-14,16,20-22,32H,4-6,9-12,15,17-18H2,1-2H3,(H,29,34)(H,30,35)/b16-3-,25-19+/t21?,22-/m0/s1 |
| InChIKey | AZFRUDGLWNUUAQ-GNGVXTOPSA-N |
| XLogP | 3.43 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|