About (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane
(3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane (PubChem CID 142098307) has the molecular formula C25H38N2O3
and a molecular weight of 414.59 g/mol. Its IUPAC name is (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane.
Molecular Properties
| Compound Name | (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane |
| PubChem CID | 142098307 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane |
| SMILES | CC.CNc1cc(OC)c(OC)cc1C=O.NCc1cccc(C2CCCCC2)c1 |
| InChI | InChI=1S/C13H19N.C10H13NO3.C2H6/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12;1-11-8-5-10(14-3)9(13-2)4-7(8)6-12;1-2/h4-5,8-9,12H,1-3,6-7,10,14H2;4-6,11H,1-3H3;1-2H3 |
| InChIKey | OGGMBTZRCPPUFG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane?
The IUPAC name of (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane (CID 142098307) is (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane.
What is the SMILES notation for (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane?
The canonical SMILES for (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane is CC.CNc1cc(OC)c(OC)cc1C=O.NCc1cccc(C2CCCCC2)c1.
What is the InChIKey of (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane?
The InChIKey is OGGMBTZRCPPUFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N.C10H13NO3.C2H6/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12;1-11-8-5-10(14-3)9(13-2)4-7(8)6-12;1-2/h4-5,8-9,12H,1-3,6-7,10,14H2;4-6,11H,1-3H3;1-2H3.
What are the key properties of (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane?
(3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane has a molecular weight of 414.59 g/mol, XLogP of 5.78, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclohexylphenyl)methanamine;4,5-dimethoxy-2-(methylamino)benzaldehyde;ethane is sourced from PubChem (CID 142098307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).