About [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate
[(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate (PubChem CID 142099238) has the molecular formula C8H9ClO2
and a molecular weight of 172.61 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate.
Molecular Properties
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate |
| PubChem CID | 142099238 |
| Molecular Formula | C8H9ClO2 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate |
| SMILES | C=C/C=C(\C=C)COC(=O)Cl |
| InChI | InChI=1S/C8H9ClO2/c1-3-5-7(4-2)6-11-8(9)10/h3-5H,1-2,6H2/b7-5+ |
| InChIKey | WSFUPJFPRYCHCK-FNORWQNLSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate?
The IUPAC name of [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate (CID 142099238) is [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate.
What is the SMILES notation for [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate?
The canonical SMILES for [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate is C=C/C=C(\C=C)COC(=O)Cl.
What is the InChIKey of [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate?
The InChIKey is WSFUPJFPRYCHCK-FNORWQNLSA-N. The full InChI is InChI=1S/C8H9ClO2/c1-3-5-7(4-2)6-11-8(9)10/h3-5H,1-2,6H2/b7-5+.
What are the key properties of [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate?
[(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate has a molecular weight of 172.61 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-2-ethenylpenta-2,4-dienyl] carbonochloridate is sourced from PubChem (CID 142099238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).