C20H30N2O — CID 142099255
(3E,5Z)-N-[(4-benzyl-1,4-oxazepan-2-yl)methyl]hepta-3,5-dien-3-amine (PubChem CID 142099255) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is (3E,5Z)-N-[(4-benzyl-1,4-oxazepan-2-yl)methyl]hepta-3,5-dien-3-amine.
| Compound Name | (3E,5Z)-N-[(4-benzyl-1,4-oxazepan-2-yl)methyl]hepta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 142099255 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | (3E,5Z)-N-[(4-benzyl-1,4-oxazepan-2-yl)methyl]hepta-3,5-dien-3-amine |
| SMILES | C/C=C\C=C(/CC)NCC1CN(Cc2ccccc2)CCCO1 |
| InChI | InChI=1S/C20H30N2O/c1-3-5-12-19(4-2)21-15-20-17-22(13-9-14-23-20)16-18-10-7-6-8-11-18/h3,5-8,10-12,20-21H,4,9,13-17H2,1-2H3/b5-3-,19-12+ |
| InChIKey | JEZZFZBRTOTDLY-JIYMZONUSA-N |
| XLogP | 3.74 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|