About 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine
2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine (PubChem CID 142099396) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine.
Molecular Properties
| Compound Name | 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine |
| PubChem CID | 142099396 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine |
| SMILES | C/C=C\C=C/CS(=O)CCN |
| InChI | InChI=1S/C8H15NOS/c1-2-3-4-5-7-11(10)8-6-9/h2-5H,6-9H2,1H3/b3-2-,5-4- |
| InChIKey | VAHICKDTOOMFHR-LDIADDGTSA-N |
| XLogP | 0.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine?
The IUPAC name of 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine (CID 142099396) is 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine.
What is the SMILES notation for 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine?
The canonical SMILES for 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine is C/C=C\C=C/CS(=O)CCN.
What is the InChIKey of 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine?
The InChIKey is VAHICKDTOOMFHR-LDIADDGTSA-N. The full InChI is InChI=1S/C8H15NOS/c1-2-3-4-5-7-11(10)8-6-9/h2-5H,6-9H2,1H3/b3-2-,5-4-.
What are the key properties of 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine?
2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine has a molecular weight of 173.28 g/mol, XLogP of 0.83, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z,4Z)-hexa-2,4-dienyl]sulfinylethanamine is sourced from PubChem (CID 142099396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).