C35H62N2O4 — CID 142099494
N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;(4S,9R,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadec-13-ene-2,6,10-trione;propane (PubChem CID 142099494) has the molecular formula C35H62N2O4 and a molecular weight of 574.89 g/mol. Its IUPAC name is N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;(4S,9R,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadec-13-ene-2,6,10-trione;propane.
| Compound Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;(4S,9R,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadec-13-ene-2,6,10-trione;propane |
|---|---|
| PubChem CID | 142099494 |
| Molecular Formula | C35H62N2O4 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.47 |
| IUPAC Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;(4S,9R,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadec-13-ene-2,6,10-trione;propane |
| SMILES | C/C1=C/CCN(C)C(=O)C[C@H](O)C(C)(C)C(=O)C(C)C[C@@H](C)C(=O)CC1.C/C=C\C(=C\C)\N=C(/C)CCC.CCC |
| InChI | InChI=1S/C21H35NO4.C11H19N.C3H8/c1-14-8-7-11-22(6)19(25)13-18(24)21(4,5)20(26)16(3)12-15(2)17(23)10-9-14;1-5-8-10(4)12-11(7-3)9-6-2;1-3-2/h8,15-16,18,24H,7,9-13H2,1-6H3;6-7,9H,5,8H2,1-4H3;3H2,1-2H3/b14-8-;9-6-,11-7-,12-10+;/t15-,16?,18+;;/m1../s1 |
| InChIKey | XNXSJYPXZLFANM-CSVNZYRISA-N |
| XLogP | 8.30 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|