About 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone
2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 142099858) has the molecular formula C19H21BrF3NO2
and a molecular weight of 432.28 g/mol. Its IUPAC name is 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone.
Molecular Properties
| Compound Name | 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone |
| PubChem CID | 142099858 |
| Molecular Formula | C19H21BrF3NO2 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | CC.CNC(=O)CBr.O=C(c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H9F3O.C3H6BrNO.C2H6/c15-14(16,17)12-9-5-4-8-11(12)13(18)10-6-2-1-3-7-10;1-5-3(6)2-4;1-2/h1-9H;2H2,1H3,(H,5,6);1-2H3 |
| InChIKey | IMNNQQMVMSMAAA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone?
The IUPAC name of 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone (CID 142099858) is 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone.
What is the SMILES notation for 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone?
The canonical SMILES for 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone is CC.CNC(=O)CBr.O=C(c1ccccc1)c1ccccc1C(F)(F)F.
What is the InChIKey of 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone?
The InChIKey is IMNNQQMVMSMAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3O.C3H6BrNO.C2H6/c15-14(16,17)12-9-5-4-8-11(12)13(18)10-6-2-1-3-7-10;1-5-3(6)2-4;1-2/h1-9H;2H2,1H3,(H,5,6);1-2H3.
What are the key properties of 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone?
2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone has a molecular weight of 432.28 g/mol, XLogP of 5.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-methylacetamide;ethane;phenyl-[2-(trifluoromethyl)phenyl]methanone is sourced from PubChem (CID 142099858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).