C19H36N2O2 — CID 142099910
ethane;(6E,7E)-6-ethylidene-1,3,4-trimethyl-7-prop-2-enylidene-1,4-diazepane-2,5-dione (PubChem CID 142099910) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is ethane;(6E,7E)-6-ethylidene-1,3,4-trimethyl-7-prop-2-enylidene-1,4-diazepane-2,5-dione.
| Compound Name | ethane;(6E,7E)-6-ethylidene-1,3,4-trimethyl-7-prop-2-enylidene-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 142099910 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | ethane;(6E,7E)-6-ethylidene-1,3,4-trimethyl-7-prop-2-enylidene-1,4-diazepane-2,5-dione |
| SMILES | C=C/C=C1C(=C/C)\C(=O)N(C)C(C)C(=O)N\1C.CC.CC.CC |
| InChI | InChI=1S/C13H18N2O2.3C2H6/c1-6-8-11-10(7-2)13(17)14(4)9(3)12(16)15(11)5;3*1-2/h6-9H,1H2,2-5H3;3*1-2H3/b10-7+,11-8+;;; |
| InChIKey | HKIOAOSNSPKRBA-DJWCYINVSA-N |
| XLogP | 4.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|