C25H55NO — CID 142099919
N,2-dimethyl-N-[(4E,6Z)-3-methylideneocta-4,6-dien-4-yl]butanamide;ethane (PubChem CID 142099919) has the molecular formula C25H55NO and a molecular weight of 385.72 g/mol. Its IUPAC name is N,2-dimethyl-N-[(4E,6Z)-3-methylideneocta-4,6-dien-4-yl]butanamide;ethane.
| Compound Name | N,2-dimethyl-N-[(4E,6Z)-3-methylideneocta-4,6-dien-4-yl]butanamide;ethane |
|---|---|
| PubChem CID | 142099919 |
| Molecular Formula | C25H55NO |
| Molecular Weight | 385.72 g/mol |
| Exact Mass | 385.43 |
| IUPAC Name | N,2-dimethyl-N-[(4E,6Z)-3-methylideneocta-4,6-dien-4-yl]butanamide;ethane |
| SMILES | C=C(CC)/C(=C\C=C/C)N(C)C(=O)C(C)CC.CC.CC.CC.CC.CC |
| InChI | InChI=1S/C15H25NO.5C2H6/c1-7-10-11-14(12(4)8-2)16(6)15(17)13(5)9-3;5*1-2/h7,10-11,13H,4,8-9H2,1-3,5-6H3;5*1-2H3/b10-7-,14-11+;;;;; |
| InChIKey | AKWYGEMQJNQMGQ-SCSOREHASA-N |
| XLogP | 9.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.72 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|