C9H14N3O5P — CID 142100270
[[[2-(hydroxyamino)-2-oxoethyl]-methylamino]-pyridin-3-ylmethyl]phosphonic acid (PubChem CID 142100270) has the molecular formula C9H14N3O5P and a molecular weight of 275.20 g/mol. Its IUPAC name is [[[2-(hydroxyamino)-2-oxoethyl]-methylamino]-pyridin-3-ylmethyl]phosphonic acid.
| Compound Name | [[[2-(hydroxyamino)-2-oxoethyl]-methylamino]-pyridin-3-ylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 142100270 |
| Molecular Formula | C9H14N3O5P |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | [[[2-(hydroxyamino)-2-oxoethyl]-methylamino]-pyridin-3-ylmethyl]phosphonic acid |
| SMILES | CN(CC(=O)NO)C(c1cccnc1)P(=O)(O)O |
| InChI | InChI=1S/C9H14N3O5P/c1-12(6-8(13)11-14)9(18(15,16)17)7-3-2-4-10-5-7/h2-5,9,14H,6H2,1H3,(H,11,13)(H2,15,16,17) |
| InChIKey | GDRRCKMPQPSJFH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|