C6H13N2O5P — CID 142100287
[[2-[acetyl(hydroxy)amino]-2-oxoethyl]amino]methyl-methylphosphinic acid (PubChem CID 142100287) has the molecular formula C6H13N2O5P and a molecular weight of 224.15 g/mol. Its IUPAC name is [[2-[acetyl(hydroxy)amino]-2-oxoethyl]amino]methyl-methylphosphinic acid.
| Compound Name | [[2-[acetyl(hydroxy)amino]-2-oxoethyl]amino]methyl-methylphosphinic acid |
|---|---|
| PubChem CID | 142100287 |
| Molecular Formula | C6H13N2O5P |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | [[2-[acetyl(hydroxy)amino]-2-oxoethyl]amino]methyl-methylphosphinic acid |
| SMILES | CC(=O)N(O)C(=O)CNCP(C)(=O)O |
| InChI | InChI=1S/C6H13N2O5P/c1-5(9)8(11)6(10)3-7-4-14(2,12)13/h7,11H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | UCQNCGUNCLPGBL-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|