C24H22Cl2N2O7 — CID 142101079
[(1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-3-[hydroxy(methoxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl] 2-chloroacetate (PubChem CID 142101079) has the molecular formula C24H22Cl2N2O7 and a molecular weight of 521.35 g/mol. Its IUPAC name is [(1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-3-[hydroxy(methoxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl] 2-chloroacetate.
| Compound Name | [(1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-3-[hydroxy(methoxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 142101079 |
| Molecular Formula | C24H22Cl2N2O7 |
| Molecular Weight | 521.35 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | [(1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-3-[hydroxy(methoxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl] 2-chloroacetate |
| SMILES | COC(O)[C@H]1Cc2c([nH]c3ccc(OC(=O)CCl)cc23)[C@@H](c2ccc3c(c2)OCO3)N1C(=O)CCl |
| InChI | InChI=1S/C24H22Cl2N2O7/c1-32-24(31)17-8-15-14-7-13(35-21(30)10-26)3-4-16(14)27-22(15)23(28(17)20(29)9-25)12-2-5-18-19(6-12)34-11-33-18/h2-7,17,23-24,27,31H,8-11H2,1H3/t17-,23-,24?/m1/s1 |
| InChIKey | AFGIGJKBNSWPCB-KWTFHKEJSA-N |
| XLogP | 3.09 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|