C17H28N2O — CID 142101459
ethene;2-(methylamino)-1-(2-methylpyrrolidin-1-yl)ethanone;toluene (PubChem CID 142101459) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is ethene;2-(methylamino)-1-(2-methylpyrrolidin-1-yl)ethanone;toluene.
| Compound Name | ethene;2-(methylamino)-1-(2-methylpyrrolidin-1-yl)ethanone;toluene |
|---|---|
| PubChem CID | 142101459 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | ethene;2-(methylamino)-1-(2-methylpyrrolidin-1-yl)ethanone;toluene |
| SMILES | C=C.CNCC(=O)N1CCCC1C.Cc1ccccc1 |
| InChI | InChI=1S/C8H16N2O.C7H8.C2H4/c1-7-4-3-5-10(7)8(11)6-9-2;1-7-5-3-2-4-6-7;1-2/h7,9H,3-6H2,1-2H3;2-6H,1H3;1-2H2 |
| InChIKey | VSDHPESVOOOTHW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|