C30H47NO4 — CID 142101512
2-[6-(4-cyclohexa-1,5-dien-1-ylbutoxy)hexyl-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethyl]amino]ethanol (PubChem CID 142101512) has the molecular formula C30H47NO4 and a molecular weight of 485.71 g/mol. Its IUPAC name is 2-[6-(4-cyclohexa-1,5-dien-1-ylbutoxy)hexyl-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethyl]amino]ethanol.
| Compound Name | 2-[6-(4-cyclohexa-1,5-dien-1-ylbutoxy)hexyl-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethyl]amino]ethanol |
|---|---|
| PubChem CID | 142101512 |
| Molecular Formula | C30H47NO4 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.35 |
| IUPAC Name | 2-[6-(4-cyclohexa-1,5-dien-1-ylbutoxy)hexyl-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethyl]amino]ethanol |
| SMILES | CC1(C)OCc2cc(CCN(CCO)CCCCCCOCCCCC3=CCCC=C3)ccc2O1 |
| InChI | InChI=1S/C30H47NO4/c1-30(2)34-25-28-24-27(15-16-29(28)35-30)17-19-31(20-21-32)18-9-3-4-10-22-33-23-11-8-14-26-12-6-5-7-13-26/h6,12-13,15-16,24,32H,3-5,7-11,14,17-23,25H2,1-2H3 |
| InChIKey | PNYJRYWUGBIXSF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|