C17H21N — CID 142101611
ethane;5,10,11,12-tetrahydrobenzo[b][1]benzazocine (PubChem CID 142101611) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;5,10,11,12-tetrahydrobenzo[b][1]benzazocine.
| Compound Name | ethane;5,10,11,12-tetrahydrobenzo[b][1]benzazocine |
|---|---|
| PubChem CID | 142101611 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | ethane;5,10,11,12-tetrahydrobenzo[b][1]benzazocine |
| SMILES | CC.c1ccc2c(c1)CCCc1ccccc1N2 |
| InChI | InChI=1S/C15H15N.C2H6/c1-3-10-14-12(6-1)8-5-9-13-7-2-4-11-15(13)16-14;1-2/h1-4,6-7,10-11,16H,5,8-9H2;1-2H3 |
| InChIKey | XYOATSOZXNFLJU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |