C20H24N3O4+ — CID 14210217
(2R,3R,4R,5R,6S)-2-[(6-amino-10-methylacridin-10-ium-3-yl)amino]-6-methyloxane-3,4,5-triol (PubChem CID 14210217) has the molecular formula C20H24N3O4+ and a molecular weight of 370.43 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-[(6-amino-10-methylacridin-10-ium-3-yl)amino]-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6S)-2-[(6-amino-10-methylacridin-10-ium-3-yl)amino]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 14210217 |
| Molecular Formula | C20H24N3O4+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-[(6-amino-10-methylacridin-10-ium-3-yl)amino]-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](Nc2ccc3cc4ccc(N)cc4[n+](C)c3c2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H23N3O4/c1-10-17(24)18(25)19(26)20(27-10)22-14-6-4-12-7-11-3-5-13(21)8-15(11)23(2)16(12)9-14/h3-10,17-20,24-26H,1-2H3,(H2,21,22)/p+1/t10-,17-,18+,19+,20+/m0/s1 |
| InChIKey | DRBVVRZEEKQEJV-NULDJFRRSA-O |
| XLogP | 0.64 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|