C29H45N — CID 142102657
(1E,3E)-1-(3,5-dimethylcyclohepta-1,4,6-trien-1-yl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-2-methylnona-1,3-dien-5-imine;ethane (PubChem CID 142102657) has the molecular formula C29H45N and a molecular weight of 407.69 g/mol. Its IUPAC name is (1E,3E)-1-(3,5-dimethylcyclohepta-1,4,6-trien-1-yl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-2-methylnona-1,3-dien-5-imine;ethane.
| Compound Name | (1E,3E)-1-(3,5-dimethylcyclohepta-1,4,6-trien-1-yl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-2-methylnona-1,3-dien-5-imine;ethane |
|---|---|
| PubChem CID | 142102657 |
| Molecular Formula | C29H45N |
| Molecular Weight | 407.69 g/mol |
| Exact Mass | 407.36 |
| IUPAC Name | (1E,3E)-1-(3,5-dimethylcyclohepta-1,4,6-trien-1-yl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-2-methylnona-1,3-dien-5-imine;ethane |
| SMILES | C=C/C=C(C=C)/N=C(/C=C/C(C)=C/C1=CC(C)C=C(C)C=C1)CCCC.CC.CC |
| InChI | InChI=1S/C25H33N.2C2H6/c1-7-10-12-25(26-24(9-3)11-8-2)16-14-21(5)18-23-15-13-20(4)17-22(6)19-23;2*1-2/h8-9,11,13-19,22H,2-3,7,10,12H2,1,4-6H3;2*1-2H3/b16-14+,21-18+,24-11+,26-25+;; |
| InChIKey | MPJYOJILPIHVQS-XGXXOGEYSA-N |
| XLogP | 9.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.69 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|