C20H19NO5S — CID 142102667
(2S)-2-[3-[(4-hydroxyphenyl)sulfonylamino]naphthalen-2-yl]butanoic acid (PubChem CID 142102667) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is (2S)-2-[3-[(4-hydroxyphenyl)sulfonylamino]naphthalen-2-yl]butanoic acid.
| Compound Name | (2S)-2-[3-[(4-hydroxyphenyl)sulfonylamino]naphthalen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 142102667 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (2S)-2-[3-[(4-hydroxyphenyl)sulfonylamino]naphthalen-2-yl]butanoic acid |
| SMILES | CC[C@H](C(=O)O)c1cc2ccccc2cc1NS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H19NO5S/c1-2-17(20(23)24)18-11-13-5-3-4-6-14(13)12-19(18)21-27(25,26)16-9-7-15(22)8-10-16/h3-12,17,21-22H,2H2,1H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | GRMGEAKAAMDLHB-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |