C14H28N2 — CID 142103532
3,3,5,5,7,7-hexamethyl-2,4,6,8-tetrahydroazonin-9-amine (PubChem CID 142103532) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 3,3,5,5,7,7-hexamethyl-2,4,6,8-tetrahydroazonin-9-amine.
| Compound Name | 3,3,5,5,7,7-hexamethyl-2,4,6,8-tetrahydroazonin-9-amine |
|---|---|
| PubChem CID | 142103532 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 3,3,5,5,7,7-hexamethyl-2,4,6,8-tetrahydroazonin-9-amine |
| SMILES | CC1(C)C/N=C(/N)CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H28N2/c1-12(2)7-11(15)16-10-14(5,6)9-13(3,4)8-12/h7-10H2,1-6H3,(H2,15,16) |
| InChIKey | NKBFFHBCVAJJAX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |