About 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane
3,5-dibromo-5-(bromomethyl)furan-2-one;hexane (PubChem CID 142103770) has the molecular formula C11H17Br3O2
and a molecular weight of 420.97 g/mol. Its IUPAC name is 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane.
Molecular Properties
| Compound Name | 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane |
| PubChem CID | 142103770 |
| Molecular Formula | C11H17Br3O2 |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 417.88 |
| IUPAC Name | 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane |
| SMILES | CCCCCC.O=C1OC(Br)(CBr)C=C1Br |
| InChI | InChI=1S/C6H14.C5H3Br3O2/c1-3-5-6-4-2;6-2-5(8)1-3(7)4(9)10-5/h3-6H2,1-2H3;1H,2H2 |
| InChIKey | GDCMYYHNFNODPC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane?
The IUPAC name of 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane (CID 142103770) is 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane.
What is the SMILES notation for 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane?
The canonical SMILES for 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane is CCCCCC.O=C1OC(Br)(CBr)C=C1Br.
What is the InChIKey of 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane?
The InChIKey is GDCMYYHNFNODPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C5H3Br3O2/c1-3-5-6-4-2;6-2-5(8)1-3(7)4(9)10-5/h3-6H2,1-2H3;1H,2H2.
What are the key properties of 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane?
3,5-dibromo-5-(bromomethyl)furan-2-one;hexane has a molecular weight of 420.97 g/mol, XLogP of 4.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-5-(bromomethyl)furan-2-one;hexane is sourced from PubChem (CID 142103770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).