C12H24O2 — CID 142104338
ethane;(3R,8R)-2,3,8-trimethyl-1,4-dioxaspiro[4.4]nonane (PubChem CID 142104338) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is ethane;(3R,8R)-2,3,8-trimethyl-1,4-dioxaspiro[4.4]nonane.
| Compound Name | ethane;(3R,8R)-2,3,8-trimethyl-1,4-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 142104338 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | ethane;(3R,8R)-2,3,8-trimethyl-1,4-dioxaspiro[4.4]nonane |
| SMILES | CC.CC1OC2(CC[C@@H](C)C2)O[C@@H]1C |
| InChI | InChI=1S/C10H18O2.C2H6/c1-7-4-5-10(6-7)11-8(2)9(3)12-10;1-2/h7-9H,4-6H2,1-3H3;1-2H3/t7-,8-,9?,10?;/m1./s1 |
| InChIKey | FKBQWOQBTLHBNI-HYQVXADHSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |