C27H35N3O5 — CID 142104512
2-[3-cyclohexyl-7-ethyl-6-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl]oxyacetic acid (PubChem CID 142104512) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is 2-[3-cyclohexyl-7-ethyl-6-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl]oxyacetic acid.
| Compound Name | 2-[3-cyclohexyl-7-ethyl-6-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 142104512 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 2-[3-cyclohexyl-7-ethyl-6-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl]oxyacetic acid |
| SMILES | C/C=C\C=C(/CC)Cc1c(CC)c(C(=O)C(N)=O)c2c(OCC(=O)O)nc(C3CCCCC3)cn12 |
| InChI | InChI=1S/C27H35N3O5/c1-4-7-11-17(5-2)14-21-19(6-3)23(25(33)26(28)34)24-27(35-16-22(31)32)29-20(15-30(21)24)18-12-9-8-10-13-18/h4,7,11,15,18H,5-6,8-10,12-14,16H2,1-3H3,(H2,28,34)(H,31,32)/b7-4-,17-11+ |
| InChIKey | AAWFNLWIIZDHAQ-NFQUWTNPSA-N |
| XLogP | 4.53 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|