C11H16O — CID 142104681
6,6-dimethyl-2,3,4,5-tetrahydrocyclohepta[b]furan (PubChem CID 142104681) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 6,6-dimethyl-2,3,4,5-tetrahydrocyclohepta[b]furan.
| Compound Name | 6,6-dimethyl-2,3,4,5-tetrahydrocyclohepta[b]furan |
|---|---|
| PubChem CID | 142104681 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 6,6-dimethyl-2,3,4,5-tetrahydrocyclohepta[b]furan |
| SMILES | CC1(C)C=CC2=C(CCO2)CC1 |
| InChI | InChI=1S/C11H16O/c1-11(2)6-3-9-5-8-12-10(9)4-7-11/h4,7H,3,5-6,8H2,1-2H3 |
| InChIKey | BFGZIERIQZEGBV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |