C12H24N2O4 — CID 142104824
tert-butyl N-(pyrrolidin-2-ylmethyl)carbamate;methyl formate (PubChem CID 142104824) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is tert-butyl N-(pyrrolidin-2-ylmethyl)carbamate;methyl formate.
| Compound Name | tert-butyl N-(pyrrolidin-2-ylmethyl)carbamate;methyl formate |
|---|---|
| PubChem CID | 142104824 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | tert-butyl N-(pyrrolidin-2-ylmethyl)carbamate;methyl formate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCN1.COC=O |
| InChI | InChI=1S/C10H20N2O2.C2H4O2/c1-10(2,3)14-9(13)12-7-8-5-4-6-11-8;1-4-2-3/h8,11H,4-7H2,1-3H3,(H,12,13);2H,1H3 |
| InChIKey | OEMBJAZZEOOWJM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|