About 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine
2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine (PubChem CID 142105661) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine.
Molecular Properties
| Compound Name | 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine |
| PubChem CID | 142105661 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine |
| SMILES | CC1=CC(N2CCNCC2C)=CCC=C1 |
| InChI | InChI=1S/C13H20N2/c1-11-5-3-4-6-13(9-11)15-8-7-14-10-12(15)2/h3,5-6,9,12,14H,4,7-8,10H2,1-2H3 |
| InChIKey | ZJUILQAAEMNACA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine?
The IUPAC name of 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine (CID 142105661) is 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine.
What is the SMILES notation for 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine?
The canonical SMILES for 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine is CC1=CC(N2CCNCC2C)=CCC=C1.
What is the InChIKey of 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine?
The InChIKey is ZJUILQAAEMNACA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-11-5-3-4-6-13(9-11)15-8-7-14-10-12(15)2/h3,5-6,9,12,14H,4,7-8,10H2,1-2H3.
What are the key properties of 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine?
2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine has a molecular weight of 204.32 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(6-methylcyclohepta-1,4,6-trien-1-yl)piperazine is sourced from PubChem (CID 142105661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).