C15H16N4OS — CID 142105960
ethene;2-methyl-3-methylimino-7-methylsulfanylindeno[1,2-e][1,2,4]triazin-9-one (PubChem CID 142105960) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is ethene;2-methyl-3-methylimino-7-methylsulfanylindeno[1,2-e][1,2,4]triazin-9-one.
| Compound Name | ethene;2-methyl-3-methylimino-7-methylsulfanylindeno[1,2-e][1,2,4]triazin-9-one |
|---|---|
| PubChem CID | 142105960 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | ethene;2-methyl-3-methylimino-7-methylsulfanylindeno[1,2-e][1,2,4]triazin-9-one |
| SMILES | C/N=c1\nc2c(nn1C)C(=O)c1cc(SC)ccc1-2.C=C |
| InChI | InChI=1S/C13H12N4OS.C2H4/c1-14-13-15-10-8-5-4-7(19-3)6-9(8)12(18)11(10)16-17(13)2;1-2/h4-6H,1-3H3;1-2H2/b14-13+; |
| InChIKey | ZSMXQSPMWCTISO-IERUDJENSA-N |
| XLogP | 2.08 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|