C13H14N4O — CID 142105998
2-amino-3-methylideneindeno[2,1-e][1,2,4]triazin-5-one;ethane (PubChem CID 142105998) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-amino-3-methylideneindeno[2,1-e][1,2,4]triazin-5-one;ethane.
| Compound Name | 2-amino-3-methylideneindeno[2,1-e][1,2,4]triazin-5-one;ethane |
|---|---|
| PubChem CID | 142105998 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-amino-3-methylideneindeno[2,1-e][1,2,4]triazin-5-one;ethane |
| SMILES | C=C1N=C2C(=O)c3ccccc3C2=NN1N.CC |
| InChI | InChI=1S/C11H8N4O.C2H6/c1-6-13-10-9(14-15(6)12)7-4-2-3-5-8(7)11(10)16;1-2/h2-5H,1,12H2;1-2H3 |
| InChIKey | QHSXMJIQHZKBCK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|