C23H28O2 — CID 14210609
2,5,7,8-tetramethyl-6-phenylmethoxy-2-prop-2-enyl-3,4-dihydrochromene (PubChem CID 14210609) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2,5,7,8-tetramethyl-6-phenylmethoxy-2-prop-2-enyl-3,4-dihydrochromene.
| Compound Name | 2,5,7,8-tetramethyl-6-phenylmethoxy-2-prop-2-enyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 14210609 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2,5,7,8-tetramethyl-6-phenylmethoxy-2-prop-2-enyl-3,4-dihydrochromene |
| SMILES | C=CCC1(C)CCc2c(C)c(OCc3ccccc3)c(C)c(C)c2O1 |
| InChI | InChI=1S/C23H28O2/c1-6-13-23(5)14-12-20-18(4)21(16(2)17(3)22(20)25-23)24-15-19-10-8-7-9-11-19/h6-11H,1,12-15H2,2-5H3 |
| InChIKey | JSWAVXOAUSNFRA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|