C10H14F3N — CID 142106510
(3E,4Z)-3-ethylidene-1,1,1-trifluoro-N-methylhepta-4,6-dien-2-amine (PubChem CID 142106510) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-1,1,1-trifluoro-N-methylhepta-4,6-dien-2-amine.
| Compound Name | (3E,4Z)-3-ethylidene-1,1,1-trifluoro-N-methylhepta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 142106510 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3E,4Z)-3-ethylidene-1,1,1-trifluoro-N-methylhepta-4,6-dien-2-amine |
| SMILES | C=C/C=C\C(=C/C)C(NC)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N/c1-4-6-7-8(5-2)9(14-3)10(11,12)13/h4-7,9,14H,1H2,2-3H3/b7-6-,8-5+ |
| InChIKey | JIMFCYKPFZVLAQ-WNXMRAAYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|