C12H17F3O — CID 142106522
ethane;1-ethoxy-2,3,6-trifluoro-4,5-dimethylbenzene (PubChem CID 142106522) has the molecular formula C12H17F3O and a molecular weight of 234.26 g/mol. Its IUPAC name is ethane;1-ethoxy-2,3,6-trifluoro-4,5-dimethylbenzene.
| Compound Name | ethane;1-ethoxy-2,3,6-trifluoro-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 142106522 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | ethane;1-ethoxy-2,3,6-trifluoro-4,5-dimethylbenzene |
| SMILES | CC.CCOc1c(F)c(C)c(C)c(F)c1F |
| InChI | InChI=1S/C10H11F3O.C2H6/c1-4-14-10-8(12)6(3)5(2)7(11)9(10)13;1-2/h4H2,1-3H3;1-2H3 |
| InChIKey | VPTNXVPMQDDWSC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|