C19H34N2 — CID 142106531
2,4-dimethyl-1-(4-methylcyclohepta-1,3,6-trien-1-yl)piperazine;ethane;prop-1-ene (PubChem CID 142106531) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 2,4-dimethyl-1-(4-methylcyclohepta-1,3,6-trien-1-yl)piperazine;ethane;prop-1-ene.
| Compound Name | 2,4-dimethyl-1-(4-methylcyclohepta-1,3,6-trien-1-yl)piperazine;ethane;prop-1-ene |
|---|---|
| PubChem CID | 142106531 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 2,4-dimethyl-1-(4-methylcyclohepta-1,3,6-trien-1-yl)piperazine;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC1=CC=C(N2CCN(C)CC2C)C=CC1 |
| InChI | InChI=1S/C14H22N2.C3H6.C2H6/c1-12-5-4-6-14(8-7-12)16-10-9-15(3)11-13(16)2;1-3-2;1-2/h4,6-8,13H,5,9-11H2,1-3H3;3H,1H2,2H3;1-2H3 |
| InChIKey | ZZKVNMCWOJSHHR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|