C17H30N2O — CID 142106560
1-[(6S)-4-methoxy-6-methylcyclohexa-1,3-dien-1-yl]-2,4-dimethylpiperazine;prop-1-ene (PubChem CID 142106560) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-[(6S)-4-methoxy-6-methylcyclohexa-1,3-dien-1-yl]-2,4-dimethylpiperazine;prop-1-ene.
| Compound Name | 1-[(6S)-4-methoxy-6-methylcyclohexa-1,3-dien-1-yl]-2,4-dimethylpiperazine;prop-1-ene |
|---|---|
| PubChem CID | 142106560 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 1-[(6S)-4-methoxy-6-methylcyclohexa-1,3-dien-1-yl]-2,4-dimethylpiperazine;prop-1-ene |
| SMILES | C=CC.COC1=CC=C(N2CCN(C)CC2C)[C@@H](C)C1 |
| InChI | InChI=1S/C14H24N2O.C3H6/c1-11-9-13(17-4)5-6-14(11)16-8-7-15(3)10-12(16)2;1-3-2/h5-6,11-12H,7-10H2,1-4H3;3H,1H2,2H3/t11-,12?;/m0./s1 |
| InChIKey | KWFBINVCZOHZPH-YLIVSKOQSA-N |
| XLogP | 3.27 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|