C5H10N4 — CID 142107204
(E)-N-(2-methyl-1,3-dihydro-1,2,4-triazol-3-yl)ethanimine (PubChem CID 142107204) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is (E)-N-(2-methyl-1,3-dihydro-1,2,4-triazol-3-yl)ethanimine.
| Compound Name | (E)-N-(2-methyl-1,3-dihydro-1,2,4-triazol-3-yl)ethanimine |
|---|---|
| PubChem CID | 142107204 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | (E)-N-(2-methyl-1,3-dihydro-1,2,4-triazol-3-yl)ethanimine |
| SMILES | C/C=N/C1N=CNN1C |
| InChI | InChI=1S/C5H10N4/c1-3-6-5-7-4-8-9(5)2/h3-5H,1-2H3,(H,7,8)/b6-3+ |
| InChIKey | FNDJJPDDOCMIMU-ZZXKWVIFSA-N |
| XLogP | -0.16 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|