About tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate
tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 142107245) has the molecular formula C20H26N2O2S
and a molecular weight of 358.51 g/mol. Its IUPAC name is tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| PubChem CID | 142107245 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CC(c1ccccc1)N1CCc2c(sc(N)c2C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H26N2O2S/c1-13(14-8-6-5-7-9-14)22-11-10-15-16(12-22)25-18(21)17(15)19(23)24-20(2,3)4/h5-9,13H,10-12,21H2,1-4H3 |
| InChIKey | IZMSDXJSVGMHEY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
The IUPAC name of tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (CID 142107245) is tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
What is the SMILES notation for tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
The canonical SMILES for tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate is CC(c1ccccc1)N1CCc2c(sc(N)c2C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
The InChIKey is IZMSDXJSVGMHEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O2S/c1-13(14-8-6-5-7-9-14)22-11-10-15-16(12-22)25-18(21)17(15)19(23)24-20(2,3)4/h5-9,13H,10-12,21H2,1-4H3.
What are the key properties of tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate has a molecular weight of 358.51 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-amino-6-(1-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate is sourced from PubChem (CID 142107245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).