C19H25Cl2F2N3O — CID 142107311
2-[4-[(3,5-dichlorophenyl)methyl]-3,5-diethylpyrazol-1-yl]-N-methylethanamine;2,2-difluoroacetaldehyde (PubChem CID 142107311) has the molecular formula C19H25Cl2F2N3O and a molecular weight of 420.33 g/mol. Its IUPAC name is 2-[4-[(3,5-dichlorophenyl)methyl]-3,5-diethylpyrazol-1-yl]-N-methylethanamine;2,2-difluoroacetaldehyde.
| Compound Name | 2-[4-[(3,5-dichlorophenyl)methyl]-3,5-diethylpyrazol-1-yl]-N-methylethanamine;2,2-difluoroacetaldehyde |
|---|---|
| PubChem CID | 142107311 |
| Molecular Formula | C19H25Cl2F2N3O |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-[4-[(3,5-dichlorophenyl)methyl]-3,5-diethylpyrazol-1-yl]-N-methylethanamine;2,2-difluoroacetaldehyde |
| SMILES | CCc1nn(CCNC)c(CC)c1Cc1cc(Cl)cc(Cl)c1.O=CC(F)F |
| InChI | InChI=1S/C17H23Cl2N3.C2H2F2O/c1-4-16-15(10-12-8-13(18)11-14(19)9-12)17(5-2)22(21-16)7-6-20-3;3-2(4)1-5/h8-9,11,20H,4-7,10H2,1-3H3;1-2H |
| InChIKey | LSINYDTURKMNHE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|