C14H18F2N2 — CID 142107326
(Z)-3-[(3,5-difluorophenyl)methyl]-4-imino-5-methylhex-2-en-2-amine (PubChem CID 142107326) has the molecular formula C14H18F2N2 and a molecular weight of 252.31 g/mol. Its IUPAC name is (Z)-3-[(3,5-difluorophenyl)methyl]-4-imino-5-methylhex-2-en-2-amine.
| Compound Name | (Z)-3-[(3,5-difluorophenyl)methyl]-4-imino-5-methylhex-2-en-2-amine |
|---|---|
| PubChem CID | 142107326 |
| Molecular Formula | C14H18F2N2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (Z)-3-[(3,5-difluorophenyl)methyl]-4-imino-5-methylhex-2-en-2-amine |
| SMILES | [H]/N=C(C(/Cc1cc(F)cc(F)c1)=C(/C)N)\C(C)C |
| InChI | InChI=1S/C14H18F2N2/c1-8(2)14(18)13(9(3)17)6-10-4-11(15)7-12(16)5-10/h4-5,7-8,18H,6,17H2,1-3H3/b13-9-,18-14+ |
| InChIKey | RSUKTRSAAUBDJC-QZWVSROASA-N |
| XLogP | 3.42 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|