C14H14F2INO6 — CID 142107548
ethyl (2E)-3-(2,3-difluoro-5-iodophenyl)-3-oxo-2-(1,2,3-trihydroxypropan-2-ylimino)propanoate (PubChem CID 142107548) has the molecular formula C14H14F2INO6 and a molecular weight of 457.17 g/mol. Its IUPAC name is ethyl (2E)-3-(2,3-difluoro-5-iodophenyl)-3-oxo-2-(1,2,3-trihydroxypropan-2-ylimino)propanoate.
| Compound Name | ethyl (2E)-3-(2,3-difluoro-5-iodophenyl)-3-oxo-2-(1,2,3-trihydroxypropan-2-ylimino)propanoate |
|---|---|
| PubChem CID | 142107548 |
| Molecular Formula | C14H14F2INO6 |
| Molecular Weight | 457.17 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | ethyl (2E)-3-(2,3-difluoro-5-iodophenyl)-3-oxo-2-(1,2,3-trihydroxypropan-2-ylimino)propanoate |
| SMILES | CCOC(=O)/C(=N/C(O)(CO)CO)C(=O)c1cc(I)cc(F)c1F |
| InChI | InChI=1S/C14H14F2INO6/c1-2-24-13(22)11(18-14(23,5-19)6-20)12(21)8-3-7(17)4-9(15)10(8)16/h3-4,19-20,23H,2,5-6H2,1H3/b18-11+ |
| InChIKey | AGUQERMMVDQFQX-WOJGMQOQSA-N |
| XLogP | 0.43 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|