About ethane;3-(methylamino)-4H-1,2,4-triazin-5-one
ethane;3-(methylamino)-4H-1,2,4-triazin-5-one (PubChem CID 142108141) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is ethane;3-(methylamino)-4H-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | ethane;3-(methylamino)-4H-1,2,4-triazin-5-one |
| PubChem CID | 142108141 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | ethane;3-(methylamino)-4H-1,2,4-triazin-5-one |
| SMILES | CC.CNc1nncc(=O)[nH]1 |
| InChI | InChI=1S/C4H6N4O.C2H6/c1-5-4-7-3(9)2-6-8-4;1-2/h2H,1H3,(H2,5,7,8,9);1-2H3 |
| InChIKey | MCASMTLCPJKDGM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;3-(methylamino)-4H-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(methylamino)-4H-1,2,4-triazin-5-one?
The IUPAC name of ethane;3-(methylamino)-4H-1,2,4-triazin-5-one (CID 142108141) is ethane;3-(methylamino)-4H-1,2,4-triazin-5-one.
What is the SMILES notation for ethane;3-(methylamino)-4H-1,2,4-triazin-5-one?
The canonical SMILES for ethane;3-(methylamino)-4H-1,2,4-triazin-5-one is CC.CNc1nncc(=O)[nH]1.
What is the InChIKey of ethane;3-(methylamino)-4H-1,2,4-triazin-5-one?
The InChIKey is MCASMTLCPJKDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O.C2H6/c1-5-4-7-3(9)2-6-8-4;1-2/h2H,1H3,(H2,5,7,8,9);1-2H3.
What are the key properties of ethane;3-(methylamino)-4H-1,2,4-triazin-5-one?
ethane;3-(methylamino)-4H-1,2,4-triazin-5-one has a molecular weight of 156.19 g/mol, XLogP of 0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(methylamino)-4H-1,2,4-triazin-5-one is sourced from PubChem (CID 142108141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).