About 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate
7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate (PubChem CID 14210842) has the molecular formula C13H21N3O6
and a molecular weight of 315.33 g/mol. Its IUPAC name is 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate.
Molecular Properties
| Compound Name | 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate |
| PubChem CID | 14210842 |
| Molecular Formula | C13H21N3O6 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate |
| SMILES | CCOC(=O)C(N)C/C=C/C(NC(=O)CNC=O)C(=O)OC |
| InChI | InChI=1S/C13H21N3O6/c1-3-22-12(19)9(14)5-4-6-10(13(20)21-2)16-11(18)7-15-8-17/h4,6,8-10H,3,5,7,14H2,1-2H3,(H,15,17)(H,16,18)/b6-4+ |
| InChIKey | CPUAQMPMHQLDRH-GQCTYLIASA-N |
| XLogP | -1.77 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate?
The IUPAC name of 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate (CID 14210842) is 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate.
What is the SMILES notation for 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate?
The canonical SMILES for 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate is CCOC(=O)C(N)C/C=C/C(NC(=O)CNC=O)C(=O)OC.
What is the InChIKey of 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate?
The InChIKey is CPUAQMPMHQLDRH-GQCTYLIASA-N. The full InChI is InChI=1S/C13H21N3O6/c1-3-22-12(19)9(14)5-4-6-10(13(20)21-2)16-11(18)7-15-8-17/h4,6,8-10H,3,5,7,14H2,1-2H3,(H,15,17)(H,16,18)/b6-4+.
What are the key properties of 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate?
7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate has a molecular weight of 315.33 g/mol, XLogP of -1.77, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-ethyl 1-O-methyl (E)-6-amino-2-[(2-formamidoacetyl)amino]hept-3-enedioate is sourced from PubChem (CID 14210842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).