About ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate
ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate (PubChem CID 14210911) has the molecular formula C24H24N2O4
and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate |
| PubChem CID | 14210911 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)OC2)C1c1ccccc1NCc1ccccc1 |
| InChI | InChI=1S/C24H24N2O4/c1-3-29-23(27)20-15(2)26-19-14-30-24(28)22(19)21(20)17-11-7-8-12-18(17)25-13-16-9-5-4-6-10-16/h4-12,21,25-26H,3,13-14H2,1-2H3 |
| InChIKey | RTCZROHKPOSJLA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate?
The IUPAC name of ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate (CID 14210911) is ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate?
The canonical SMILES for ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate is CCOC(=O)C1=C(C)NC2=C(C(=O)OC2)C1c1ccccc1NCc1ccccc1.
What is the InChIKey of ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate?
The InChIKey is RTCZROHKPOSJLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O4/c1-3-29-23(27)20-15(2)26-19-14-30-24(28)22(19)21(20)17-11-7-8-12-18(17)25-13-16-9-5-4-6-10-16/h4-12,21,25-26H,3,13-14H2,1-2H3.
What are the key properties of ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate?
ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate has a molecular weight of 404.47 g/mol, XLogP of 3.63, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-(benzylamino)phenyl]-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate is sourced from PubChem (CID 14210911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).