C18H26N2O — CID 142109230
N-(3-cyanopropyl)-2,2,4-trimethyl-4-phenylpentanamide (PubChem CID 142109230) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-(3-cyanopropyl)-2,2,4-trimethyl-4-phenylpentanamide.
| Compound Name | N-(3-cyanopropyl)-2,2,4-trimethyl-4-phenylpentanamide |
|---|---|
| PubChem CID | 142109230 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-(3-cyanopropyl)-2,2,4-trimethyl-4-phenylpentanamide |
| SMILES | CC(C)(CC(C)(C)c1ccccc1)C(=O)NCCCC#N |
| InChI | InChI=1S/C18H26N2O/c1-17(2,15-10-6-5-7-11-15)14-18(3,4)16(21)20-13-9-8-12-19/h5-7,10-11H,8-9,13-14H2,1-4H3,(H,20,21) |
| InChIKey | BHKMDBYXUKXLPB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|