C21H18N2OS — CID 14210953
6-ethoxy-2,3-diphenyl-1H-pyrido[2,3-b][1,4]thiazine (PubChem CID 14210953) has the molecular formula C21H18N2OS and a molecular weight of 346.46 g/mol. Its IUPAC name is 6-ethoxy-2,3-diphenyl-1H-pyrido[2,3-b][1,4]thiazine.
| Compound Name | 6-ethoxy-2,3-diphenyl-1H-pyrido[2,3-b][1,4]thiazine |
|---|---|
| PubChem CID | 14210953 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 6-ethoxy-2,3-diphenyl-1H-pyrido[2,3-b][1,4]thiazine |
| SMILES | CCOc1ccc2c(n1)SC(c1ccccc1)=C(c1ccccc1)N2 |
| InChI | InChI=1S/C21H18N2OS/c1-2-24-18-14-13-17-21(23-18)25-20(16-11-7-4-8-12-16)19(22-17)15-9-5-3-6-10-15/h3-14,22H,2H2,1H3 |
| InChIKey | KTWNENZDJPZXMH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|