C34H63NO4 — CID 142109974
but-1-ene;(3S)-4,4-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]pentan-2-one;3-ethenylidene-6-[2-(3-ethyl-2,2-dimethylcyclopropyl)propoxy]-5-methylhexan-2-one (PubChem CID 142109974) has the molecular formula C34H63NO4 and a molecular weight of 549.88 g/mol. Its IUPAC name is but-1-ene;(3S)-4,4-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]pentan-2-one;3-ethenylidene-6-[2-(3-ethyl-2,2-dimethylcyclopropyl)propoxy]-5-methylhexan-2-one.
| Compound Name | but-1-ene;(3S)-4,4-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]pentan-2-one;3-ethenylidene-6-[2-(3-ethyl-2,2-dimethylcyclopropyl)propoxy]-5-methylhexan-2-one |
|---|---|
| PubChem CID | 142109974 |
| Molecular Formula | C34H63NO4 |
| Molecular Weight | 549.88 g/mol |
| Exact Mass | 549.48 |
| IUPAC Name | but-1-ene;(3S)-4,4-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]pentan-2-one;3-ethenylidene-6-[2-(3-ethyl-2,2-dimethylcyclopropyl)propoxy]-5-methylhexan-2-one |
| SMILES | C=C=C(CC(C)COCC(C)C1C(CC)C1(C)C)C(C)=O.C=CCC.CC(=O)[C@@H](NOC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H32O2.C11H23NO2.C4H8/c1-8-16(15(5)20)10-13(3)11-21-12-14(4)18-17(9-2)19(18,6)7;1-8(13)9(10(2,3)4)12-14-11(5,6)7;1-3-4-2/h13-14,17-18H,1,9-12H2,2-7H3;9,12H,1-7H3;3H,1,4H2,2H3/t;9-;/m.1./s1 |
| InChIKey | FFSSTTYTOPVWSN-IQPANZSWSA-N |
| XLogP | 8.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.88 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|