C31H44S — CID 142110070
6-but-3-enyl-2-(2,3-dihydro-1H-inden-2-yl)-5-(3-ethyl-2,2-dimethylcyclopropyl)-7-methylidenedec-9-ene-3-thione (PubChem CID 142110070) has the molecular formula C31H44S and a molecular weight of 448.76 g/mol. Its IUPAC name is 6-but-3-enyl-2-(2,3-dihydro-1H-inden-2-yl)-5-(3-ethyl-2,2-dimethylcyclopropyl)-7-methylidenedec-9-ene-3-thione.
| Compound Name | 6-but-3-enyl-2-(2,3-dihydro-1H-inden-2-yl)-5-(3-ethyl-2,2-dimethylcyclopropyl)-7-methylidenedec-9-ene-3-thione |
|---|---|
| PubChem CID | 142110070 |
| Molecular Formula | C31H44S |
| Molecular Weight | 448.76 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 6-but-3-enyl-2-(2,3-dihydro-1H-inden-2-yl)-5-(3-ethyl-2,2-dimethylcyclopropyl)-7-methylidenedec-9-ene-3-thione |
| SMILES | C=CCCC(C(=C)CC=C)C(CC(=S)C(C)C1Cc2ccccc2C1)C1C(CC)C1(C)C |
| InChI | InChI=1S/C31H44S/c1-8-11-17-26(21(4)14-9-2)27(30-28(10-3)31(30,6)7)20-29(32)22(5)25-18-23-15-12-13-16-24(23)19-25/h8-9,12-13,15-16,22,25-28,30H,1-2,4,10-11,14,17-20H2,3,5-7H3 |
| InChIKey | WKMLFGXHXLTTNG-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.76 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|