C34H60N4S — CID 142110083
5-cyclobutyl-4-N-[3-(3-ethyl-2,2-dimethylcyclopropyl)but-1-en-2-yl]-3-methylidenepent-1-ene-2,4-diamine;3-(1-cyclohexyl-2-methylprop-2-enyl)-1,1-dimethylthiourea (PubChem CID 142110083) has the molecular formula C34H60N4S and a molecular weight of 556.95 g/mol. Its IUPAC name is 5-cyclobutyl-4-N-[3-(3-ethyl-2,2-dimethylcyclopropyl)but-1-en-2-yl]-3-methylidenepent-1-ene-2,4-diamine;3-(1-cyclohexyl-2-methylprop-2-enyl)-1,1-dimethylthiourea.
| Compound Name | 5-cyclobutyl-4-N-[3-(3-ethyl-2,2-dimethylcyclopropyl)but-1-en-2-yl]-3-methylidenepent-1-ene-2,4-diamine;3-(1-cyclohexyl-2-methylprop-2-enyl)-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 142110083 |
| Molecular Formula | C34H60N4S |
| Molecular Weight | 556.95 g/mol |
| Exact Mass | 556.45 |
| IUPAC Name | 5-cyclobutyl-4-N-[3-(3-ethyl-2,2-dimethylcyclopropyl)but-1-en-2-yl]-3-methylidenepent-1-ene-2,4-diamine;3-(1-cyclohexyl-2-methylprop-2-enyl)-1,1-dimethylthiourea |
| SMILES | C=C(C)C(NC(=S)N(C)C)C1CCCCC1.C=C(N)C(=C)C(CC1CCC1)NC(=C)C(C)C1C(CC)C1(C)C |
| InChI | InChI=1S/C21H36N2.C13H24N2S/c1-8-18-20(21(18,6)7)14(3)16(5)23-19(13(2)15(4)22)12-17-10-9-11-17;1-10(2)12(14-13(16)15(3)4)11-8-6-5-7-9-11/h14,17-20,23H,2,4-5,8-12,22H2,1,3,6-7H3;11-12H,1,5-9H2,2-4H3,(H,14,16) |
| InChIKey | XFJZVFRTOBTAOH-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.95 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|