C10H8F2O6 — CID 142110891
(3R,4R)-3-(1-carboxy-2,2-difluoroethenoxy)-4-hydroxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 142110891) has the molecular formula C10H8F2O6 and a molecular weight of 262.16 g/mol. Its IUPAC name is (3R,4R)-3-(1-carboxy-2,2-difluoroethenoxy)-4-hydroxycyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | (3R,4R)-3-(1-carboxy-2,2-difluoroethenoxy)-4-hydroxycyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 142110891 |
| Molecular Formula | C10H8F2O6 |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | (3R,4R)-3-(1-carboxy-2,2-difluoroethenoxy)-4-hydroxycyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=C[C@@H](OC(C(=O)O)=C(F)F)[C@H](O)C=C1 |
| InChI | InChI=1S/C10H8F2O6/c11-8(12)7(10(16)17)18-6-3-4(9(14)15)1-2-5(6)13/h1-3,5-6,13H,(H,14,15)(H,16,17)/t5-,6-/m1/s1 |
| InChIKey | WQGAPVYOBKMRDP-PHDIDXHHSA-N |
| XLogP | 0.51 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|