C27H33N3O — CID 142110951
(3S)-N-(2,6,7,8,9,10-hexahydroheptalen-3-yl)-N-[(1-methylimidazol-2-yl)methyl]-3-phenylbutanamide (PubChem CID 142110951) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is (3S)-N-(2,6,7,8,9,10-hexahydroheptalen-3-yl)-N-[(1-methylimidazol-2-yl)methyl]-3-phenylbutanamide.
| Compound Name | (3S)-N-(2,6,7,8,9,10-hexahydroheptalen-3-yl)-N-[(1-methylimidazol-2-yl)methyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 142110951 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (3S)-N-(2,6,7,8,9,10-hexahydroheptalen-3-yl)-N-[(1-methylimidazol-2-yl)methyl]-3-phenylbutanamide |
| SMILES | C[C@@H](CC(=O)N(Cc1nccn1C)C1=CC=C2CCCCCC2=CC1)c1ccccc1 |
| InChI | InChI=1S/C27H33N3O/c1-21(22-9-5-3-6-10-22)19-27(31)30(20-26-28-17-18-29(26)2)25-15-13-23-11-7-4-8-12-24(23)14-16-25/h3,5-6,9-10,13-15,17-18,21H,4,7-8,11-12,16,19-20H2,1-2H3/t21-/m0/s1 |
| InChIKey | VMCOJFSHZDWWCV-NRFANRHFSA-N |
| XLogP | 6.05 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |